C14H33NO3 — CID 171107207
ethane;3-methylcyclopentane-1-carboxamide;propane-2,2-diol (PubChem CID 171107207) has the molecular formula C14H33NO3 and a molecular weight of 263.42 g/mol. Its IUPAC name is ethane;3-methylcyclopentane-1-carboxamide;propane-2,2-diol.
| Compound Name | ethane;3-methylcyclopentane-1-carboxamide;propane-2,2-diol |
|---|---|
| PubChem CID | 171107207 |
| Molecular Formula | C14H33NO3 |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.25 |
| IUPAC Name | ethane;3-methylcyclopentane-1-carboxamide;propane-2,2-diol |
| SMILES | CC.CC.CC(C)(O)O.CC1CCC(C(N)=O)C1 |
| InChI | InChI=1S/C7H13NO.C3H8O2.2C2H6/c1-5-2-3-6(4-5)7(8)9;1-3(2,4)5;2*1-2/h5-6H,2-4H2,1H3,(H2,8,9);4-5H,1-2H3;2*1-2H3 |
| InChIKey | LSHKJLNFCUTSHD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|