C11H23NO — CID 91164443
(1R,2R,4S)-2,4-dimethylcyclohexane-1-carboxamide;ethane (PubChem CID 91164443) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (1R,2R,4S)-2,4-dimethylcyclohexane-1-carboxamide;ethane.
| Compound Name | (1R,2R,4S)-2,4-dimethylcyclohexane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 91164443 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (1R,2R,4S)-2,4-dimethylcyclohexane-1-carboxamide;ethane |
| SMILES | CC.C[C@H]1CC[C@@H](C(N)=O)[C@H](C)C1 |
| InChI | InChI=1S/C9H17NO.C2H6/c1-6-3-4-8(9(10)11)7(2)5-6;1-2/h6-8H,3-5H2,1-2H3,(H2,10,11);1-2H3/t6-,7+,8+;/m0./s1 |
| InChIKey | UQLAFRJFPIJCTJ-HNPMAXIBSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |