C10H22N2O — CID 166075774
1,3-dimethylpiperidine-4-carboxamide;ethane (PubChem CID 166075774) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,3-dimethylpiperidine-4-carboxamide;ethane.
| Compound Name | 1,3-dimethylpiperidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 166075774 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1,3-dimethylpiperidine-4-carboxamide;ethane |
| SMILES | CC.CC1CN(C)CCC1C(N)=O |
| InChI | InChI=1S/C8H16N2O.C2H6/c1-6-5-10(2)4-3-7(6)8(9)11;1-2/h6-7H,3-5H2,1-2H3,(H2,9,11);1-2H3 |
| InChIKey | GJGMOKZXBHIPEO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |