C9H17NO2 — CID 20696711
(1,3-dimethylpiperidin-4-yl) acetate (PubChem CID 20696711) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (1,3-dimethylpiperidin-4-yl) acetate.
| Compound Name | (1,3-dimethylpiperidin-4-yl) acetate |
|---|---|
| PubChem CID | 20696711 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (1,3-dimethylpiperidin-4-yl) acetate |
| SMILES | CC(=O)OC1CCN(C)CC1C |
| InChI | InChI=1S/C9H17NO2/c1-7-6-10(3)5-4-9(7)12-8(2)11/h7,9H,4-6H2,1-3H3 |
| InChIKey | VCXHPVXKTYFIBL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |