C8H16N2O2 — CID 175039097
(1,4-dimethylpiperazin-2-yl) acetate (PubChem CID 175039097) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (1,4-dimethylpiperazin-2-yl) acetate.
| Compound Name | (1,4-dimethylpiperazin-2-yl) acetate |
|---|---|
| PubChem CID | 175039097 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (1,4-dimethylpiperazin-2-yl) acetate |
| SMILES | CC(=O)OC1CN(C)CCN1C |
| InChI | InChI=1S/C8H16N2O2/c1-7(11)12-8-6-9(2)4-5-10(8)3/h8H,4-6H2,1-3H3 |
| InChIKey | IAFIFPLJZLTHJB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |