C12H28N4O — CID 173283248
2-methoxy-1,4,10-trimethyl-1,4,7,10-tetrazacyclododecane (PubChem CID 173283248) has the molecular formula C12H28N4O and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-methoxy-1,4,10-trimethyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | 2-methoxy-1,4,10-trimethyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 173283248 |
| Molecular Formula | C12H28N4O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 2-methoxy-1,4,10-trimethyl-1,4,7,10-tetrazacyclododecane |
| SMILES | COC1CN(C)CCNCCN(C)CCN1C |
| InChI | InChI=1S/C12H28N4O/c1-14-7-5-13-6-8-15(2)11-12(17-4)16(3)10-9-14/h12-13H,5-11H2,1-4H3 |
| InChIKey | LEPUCTMJZPJBRP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |