C9H18N2O2 — CID 118068295
methyl 1,4-dimethyl-1,4-diazepane-6-carboxylate (PubChem CID 118068295) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 1,4-dimethyl-1,4-diazepane-6-carboxylate.
| Compound Name | methyl 1,4-dimethyl-1,4-diazepane-6-carboxylate |
|---|---|
| PubChem CID | 118068295 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | methyl 1,4-dimethyl-1,4-diazepane-6-carboxylate |
| SMILES | COC(=O)C1CN(C)CCN(C)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-10-4-5-11(2)7-8(6-10)9(12)13-3/h8H,4-7H2,1-3H3 |
| InChIKey | NXBYRIVVTABYNO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |