About methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate
methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate (PubChem CID 20975306) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate.
Analyze methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate?
The IUPAC name of methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate (CID 20975306) is methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate.
What is the SMILES notation for methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate?
The canonical SMILES for methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate is COC(=O)C1CC=CN(C)C1.
What is the InChIKey of methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate?
The InChIKey is JYQWWGGJTICZIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-9-5-3-4-7(6-9)8(10)11-2/h3,5,7H,4,6H2,1-2H3.
What are the key properties of methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate?
methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate has a molecular weight of 155.20 g/mol, XLogP of 0.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methyl-3,4-dihydro-2H-pyridine-3-carboxylate is sourced from PubChem (CID 20975306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).