C13H20O3 — CID 162089386
cyclopent-3-en-1-ylmethanol;methyl cyclopent-3-ene-1-carboxylate (PubChem CID 162089386) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is cyclopent-3-en-1-ylmethanol;methyl cyclopent-3-ene-1-carboxylate.
| Compound Name | cyclopent-3-en-1-ylmethanol;methyl cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 162089386 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | cyclopent-3-en-1-ylmethanol;methyl cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=CC1.OCC1CC=CC1 |
| InChI | InChI=1S/C7H10O2.C6H10O/c1-9-7(8)6-4-2-3-5-6;7-5-6-3-1-2-4-6/h2-3,6H,4-5H2,1H3;1-2,6-7H,3-5H2 |
| InChIKey | ZDJXUYQDYHWCAX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|