C19H32O7 — CID 158577027
cyclohex-3-en-1-ylmethanol;cyclohex-3-en-1-ylmethyl 2-hydroxyacetate;methyl 2-hydroxyacetate (PubChem CID 158577027) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethanol;cyclohex-3-en-1-ylmethyl 2-hydroxyacetate;methyl 2-hydroxyacetate.
| Compound Name | cyclohex-3-en-1-ylmethanol;cyclohex-3-en-1-ylmethyl 2-hydroxyacetate;methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 158577027 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | cyclohex-3-en-1-ylmethanol;cyclohex-3-en-1-ylmethyl 2-hydroxyacetate;methyl 2-hydroxyacetate |
| SMILES | COC(=O)CO.O=C(CO)OCC1CC=CCC1.OCC1CC=CCC1 |
| InChI | InChI=1S/C9H14O3.C7H12O.C3H6O3/c10-6-9(11)12-7-8-4-2-1-3-5-8;8-6-7-4-2-1-3-5-7;1-6-3(5)2-4/h1-2,8,10H,3-7H2;1-2,7-8H,3-6H2;4H,2H2,1H3 |
| InChIKey | HSUCISKWLKSASY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|