C13H22O2S — CID 119037854
cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate (PubChem CID 119037854) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate.
| Compound Name | cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 119037854 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate |
| SMILES | CSCC(C)(C)C(=O)OCC1CC=CCC1 |
| InChI | InChI=1S/C13H22O2S/c1-13(2,10-16-3)12(14)15-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3 |
| InChIKey | UUQRDGAOJXKGSH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|