cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate

C13H22O2S — CID 119037854

IUPACcyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate
SMILESCSCC(C)(C)C(=O)OCC1CC=CCC1
InChIInChI=1S/C13H22O2S/c1-13(2,10-16-3)12(14)15-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3
InChIKeyUUQRDGAOJXKGSH-UHFFFAOYSA-N
MW242.38 g/mol
LogP3.28
Rot. Bonds5

About cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate

cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate (PubChem CID 119037854) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate.

Molecular Properties

Compound Namecyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate
PubChem CID119037854
Molecular FormulaC13H22O2S
Molecular Weight242.38 g/mol
Exact Mass242.13
IUPAC Namecyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate
SMILESCSCC(C)(C)C(=O)OCC1CC=CCC1
InChIInChI=1S/C13H22O2S/c1-13(2,10-16-3)12(14)15-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3
InChIKeyUUQRDGAOJXKGSH-UHFFFAOYSA-N
XLogP3.28
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.38
LogP ≤ 53.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate?
The IUPAC name of cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate (CID 119037854) is cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate.
What is the SMILES notation for cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate?
The canonical SMILES for cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate is CSCC(C)(C)C(=O)OCC1CC=CCC1.
What is the InChIKey of cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate?
The InChIKey is UUQRDGAOJXKGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2S/c1-13(2,10-16-3)12(14)15-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3.
What are the key properties of cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate?
cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate has a molecular weight of 242.38 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-en-1-ylmethyl 2,2-dimethyl-3-methylsulfanylpropanoate is sourced from PubChem (CID 119037854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).