C14H22O2 — CID 66696550
cyclohex-3-en-1-ylmethyl cyclohexanecarboxylate (PubChem CID 66696550) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl cyclohexanecarboxylate.
| Compound Name | cyclohex-3-en-1-ylmethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66696550 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl cyclohexanecarboxylate |
| SMILES | O=C(OCC1CC=CCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H22O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1,3,12-13H,2,4-11H2 |
| InChIKey | NJWFEHJZZDZRIX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|