C16H25NO3 — CID 55313115
[2-(cyclohexylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate (PubChem CID 55313115) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 55313115 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)C1CC=CCC1)NCC1CCCCC1 |
| InChI | InChI=1S/C16H25NO3/c18-15(17-11-13-7-3-1-4-8-13)12-20-16(19)14-9-5-2-6-10-14/h2,5,13-14H,1,3-4,6-12H2,(H,17,18) |
| InChIKey | BEQYTUKUDGKBQK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|