C14H23NO3 — CID 55314858
[2-(cyclohexylmethylamino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate (PubChem CID 55314858) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55314858 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate |
| SMILES | CC1CC1C(=O)OCC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C14H23NO3/c1-10-7-12(10)14(17)18-9-13(16)15-8-11-5-3-2-4-6-11/h10-12H,2-9H2,1H3,(H,15,16) |
| InChIKey | ZXUCYZRDYONBEN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |