C18H22N2O4 — CID 7949074
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 7949074) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7949074 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)[C@@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-20(2)17(22)13-8-10-15(11-9-13)19-16(21)12-24-18(23)14-6-4-3-5-7-14/h3-4,8-11,14H,5-7,12H2,1-2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | QYYOKLVGVRJHJD-CQSZACIVSA-N |
| XLogP | 2.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|