C15H15F2NO3 — CID 7932619
[2-(3,4-difluoroanilino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932619) has the molecular formula C15H15F2NO3 and a molecular weight of 295.28 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932619 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC=CCC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H15F2NO3/c16-12-7-6-11(8-13(12)17)18-14(19)9-21-15(20)10-4-2-1-3-5-10/h1-2,6-8,10H,3-5,9H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | UYYZSICBSFLLIW-SNVBAGLBSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|