C22H23NO4 — CID 7932593
[2-oxo-2-(4-phenylmethoxyanilino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932593) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylmethoxyanilino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylmethoxyanilino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932593 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [2-oxo-2-(4-phenylmethoxyanilino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC=CCC1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO4/c24-21(16-27-22(25)18-9-5-2-6-10-18)23-19-11-13-20(14-12-19)26-15-17-7-3-1-4-8-17/h1-5,7-8,11-14,18H,6,9-10,15-16H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | CCYJYVHCTWTBFG-GOSISDBHSA-N |
| XLogP | 4.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|