C17H19NO5 — CID 7932098
[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932098) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932098 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC=CCC1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H19NO5/c19-16(11-23-17(20)12-4-2-1-3-5-12)18-13-6-7-14-15(10-13)22-9-8-21-14/h1-2,6-7,10,12H,3-5,8-9,11H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | QJHYMVNJOOQRDD-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|