C21H25NO5 — CID 9487753
[2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 9487753) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 9487753 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)ethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC=CCC1)Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C21H25NO5/c23-19(14-25-20(24)15-7-3-1-4-8-15)22-16-9-10-17-18(13-16)27-21(26-17)11-5-2-6-12-21/h1,3,9-10,13,15H,2,4-8,11-12,14H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | SVRBIKXYRUOXGG-OAHLLOKOSA-N |
| XLogP | 3.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|