C16H23NO3 — CID 55524534
[2-(dicyclopropylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate (PubChem CID 55524534) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [2-(dicyclopropylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-(dicyclopropylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 55524534 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [2-(dicyclopropylmethylamino)-2-oxoethyl] cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(COC(=O)C1CC=CCC1)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C16H23NO3/c18-14(17-15(11-6-7-11)12-8-9-12)10-20-16(19)13-4-2-1-3-5-13/h1-2,11-13,15H,3-10H2,(H,17,18) |
| InChIKey | XENNJGHWOZNRCC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|