C19H20N2O4 — CID 9487746
[2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 9487746) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 9487746 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1ccc(-c2cc(NC(=O)COC(=O)[C@H]3CC=CCC3)on2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-13-7-9-14(10-8-13)16-11-18(25-21-16)20-17(22)12-24-19(23)15-5-3-2-4-6-15/h2-3,7-11,15H,4-6,12H2,1H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | INHQDKWPUGKUSZ-HNNXBMFYSA-N |
| XLogP | 3.49 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|