C13H16N2O4 — CID 7932127
[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932127) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932127 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1cc(NC(=O)COC(=O)[C@H]2CC=CCC2)no1 |
| InChI | InChI=1S/C13H16N2O4/c1-9-7-11(15-19-9)14-12(16)8-18-13(17)10-5-3-2-4-6-10/h2-3,7,10H,4-6,8H2,1H3,(H,14,15,16)/t10-/m0/s1 |
| InChIKey | KSODHARQXUSOAX-JTQLQIEISA-N |
| XLogP | 1.82 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|