C10H18N2O4 — CID 112542985
methyl 5-(methoxycarbonylamino)-1-methylpiperidine-3-carboxylate (PubChem CID 112542985) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 5-(methoxycarbonylamino)-1-methylpiperidine-3-carboxylate.
| Compound Name | methyl 5-(methoxycarbonylamino)-1-methylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 112542985 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | methyl 5-(methoxycarbonylamino)-1-methylpiperidine-3-carboxylate |
| SMILES | COC(=O)NC1CC(C(=O)OC)CN(C)C1 |
| InChI | InChI=1S/C10H18N2O4/c1-12-5-7(9(13)15-2)4-8(6-12)11-10(14)16-3/h7-8H,4-6H2,1-3H3,(H,11,14) |
| InChIKey | HBIBGDVMEKXHAS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |