C11H19N3O5 — CID 112543811
methyl 1-carbamoyl-5-(ethoxycarbonylamino)piperidine-3-carboxylate (PubChem CID 112543811) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 1-carbamoyl-5-(ethoxycarbonylamino)piperidine-3-carboxylate.
| Compound Name | methyl 1-carbamoyl-5-(ethoxycarbonylamino)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 112543811 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | methyl 1-carbamoyl-5-(ethoxycarbonylamino)piperidine-3-carboxylate |
| SMILES | CCOC(=O)NC1CC(C(=O)OC)CN(C(N)=O)C1 |
| InChI | InChI=1S/C11H19N3O5/c1-3-19-11(17)13-8-4-7(9(15)18-2)5-14(6-8)10(12)16/h7-8H,3-6H2,1-2H3,(H2,12,16)(H,13,17) |
| InChIKey | OAWDRHYEQUYJRC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |