C18H34N2O6Si — CID 11395541
1-O-tert-butyl 3-O-methyl (3S,5R)-5-(2-trimethylsilylethoxycarbonylamino)piperidine-1,3-dicarboxylate (PubChem CID 11395541) has the molecular formula C18H34N2O6Si and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3S,5R)-5-(2-trimethylsilylethoxycarbonylamino)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3S,5R)-5-(2-trimethylsilylethoxycarbonylamino)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11395541 |
| Molecular Formula | C18H34N2O6Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3S,5R)-5-(2-trimethylsilylethoxycarbonylamino)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](NC(=O)OCC[Si](C)(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H34N2O6Si/c1-18(2,3)26-17(23)20-11-13(15(21)24-4)10-14(12-20)19-16(22)25-8-9-27(5,6)7/h13-14H,8-12H2,1-7H3,(H,19,22)/t13-,14+/m0/s1 |
| InChIKey | ABJQSJPDHWUKRP-UONOGXRCSA-N |
| XLogP | 2.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|