C14H23Cl3N2O4 — CID 143793103
tert-butyl (3S,5R)-3-methyl-5-(2,2,2-trichloroethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 143793103) has the molecular formula C14H23Cl3N2O4 and a molecular weight of 389.71 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3-methyl-5-(2,2,2-trichloroethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3-methyl-5-(2,2,2-trichloroethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143793103 |
| Molecular Formula | C14H23Cl3N2O4 |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | tert-butyl (3S,5R)-3-methyl-5-(2,2,2-trichloroethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](NC(=O)OCC(Cl)(Cl)Cl)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23Cl3N2O4/c1-9-5-10(18-11(20)22-8-14(15,16)17)7-19(6-9)12(21)23-13(2,3)4/h9-10H,5-8H2,1-4H3,(H,18,20)/t9-,10+/m0/s1 |
| InChIKey | PFEJVOKKKWIKCX-VHSXEESVSA-N |
| XLogP | 3.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|