C17H31N3O2 — CID 123157765
tert-butyl N-[1-(4-imino-2-methylpent-2-en-3-yl)-5-methylpiperidin-3-yl]carbamate (PubChem CID 123157765) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl N-[1-(4-imino-2-methylpent-2-en-3-yl)-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-imino-2-methylpent-2-en-3-yl)-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123157765 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | tert-butyl N-[1-(4-imino-2-methylpent-2-en-3-yl)-5-methylpiperidin-3-yl]carbamate |
| SMILES | [H]/N=C(\C)C(=C(C)C)N1CC(C)CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H31N3O2/c1-11(2)15(13(4)18)20-9-12(3)8-14(10-20)19-16(21)22-17(5,6)7/h12,14,18H,8-10H2,1-7H3,(H,19,21)/b18-13+ |
| InChIKey | MFSHTRBOIOOPES-QGOAFFKASA-N |
| XLogP | 3.56 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|