C16H28N2O5 — CID 112544479
methyl 3-[1-acetyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]propanoate (PubChem CID 112544479) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 3-[1-acetyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]propanoate.
| Compound Name | methyl 3-[1-acetyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 112544479 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl 3-[1-acetyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]propanoate |
| SMILES | COC(=O)CCC1CC(NC(=O)OC(C)(C)C)CN(C(C)=O)C1 |
| InChI | InChI=1S/C16H28N2O5/c1-11(19)18-9-12(6-7-14(20)22-5)8-13(10-18)17-15(21)23-16(2,3)4/h12-13H,6-10H2,1-5H3,(H,17,21) |
| InChIKey | CBVMIEQBYUGBQK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |