C16H30N2O4 — CID 112544764
methyl 3-[3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate (PubChem CID 112544764) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl 3-[3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate.
| Compound Name | methyl 3-[3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 112544764 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | methyl 3-[3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate |
| SMILES | CCC1CC(NC(=O)OC(C)(C)C)CN(CCC(=O)OC)C1 |
| InChI | InChI=1S/C16H30N2O4/c1-6-12-9-13(17-15(20)22-16(2,3)4)11-18(10-12)8-7-14(19)21-5/h12-13H,6-11H2,1-5H3,(H,17,20) |
| InChIKey | MUZZVUODMINSNU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |