C15H28N2O4 — CID 112544763
methyl 3-[3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate (PubChem CID 112544763) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 3-[3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate.
| Compound Name | methyl 3-[3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 112544763 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | methyl 3-[3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1CC(C)CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N2O4/c1-11-8-12(16-14(19)21-15(2,3)4)10-17(9-11)7-6-13(18)20-5/h11-12H,6-10H2,1-5H3,(H,16,19) |
| InChIKey | MFCRXLJBUVXHBF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |