C15H27N3O5 — CID 112544454
ethyl 2-[1-carbamoyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]acetate (PubChem CID 112544454) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 2-[1-carbamoyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[1-carbamoyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 112544454 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethyl 2-[1-carbamoyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)CC1CC(NC(=O)OC(C)(C)C)CN(C(N)=O)C1 |
| InChI | InChI=1S/C15H27N3O5/c1-5-22-12(19)7-10-6-11(9-18(8-10)13(16)20)17-14(21)23-15(2,3)4/h10-11H,5-9H2,1-4H3,(H2,16,20)(H,17,21) |
| InChIKey | MDAQZUBIRYBIJO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |