C11H18N2O6 — CID 112543144
dimethyl 5-(methoxycarbonylamino)piperidine-1,3-dicarboxylate (PubChem CID 112543144) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is dimethyl 5-(methoxycarbonylamino)piperidine-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(methoxycarbonylamino)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 112543144 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | dimethyl 5-(methoxycarbonylamino)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)NC1CC(C(=O)OC)CN(C(=O)OC)C1 |
| InChI | InChI=1S/C11H18N2O6/c1-17-9(14)7-4-8(12-10(15)18-2)6-13(5-7)11(16)19-3/h7-8H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | IIWFYTVGZCBRHV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|