C13H24N2O5 — CID 112543799
ethyl 3-(ethoxycarbonylamino)-5-(1-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 112543799) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is ethyl 3-(ethoxycarbonylamino)-5-(1-hydroxyethyl)piperidine-1-carboxylate.
| Compound Name | ethyl 3-(ethoxycarbonylamino)-5-(1-hydroxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112543799 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | ethyl 3-(ethoxycarbonylamino)-5-(1-hydroxyethyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)NC1CC(C(C)O)CN(C(=O)OCC)C1 |
| InChI | InChI=1S/C13H24N2O5/c1-4-19-12(17)14-11-6-10(9(3)16)7-15(8-11)13(18)20-5-2/h9-11,16H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | YILSTIYUNKDGAZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |