C12H22N2O5 — CID 112543786
methyl 3-(ethoxycarbonylamino)-5-(2-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 112543786) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 3-(ethoxycarbonylamino)-5-(2-hydroxyethyl)piperidine-1-carboxylate.
| Compound Name | methyl 3-(ethoxycarbonylamino)-5-(2-hydroxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112543786 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | methyl 3-(ethoxycarbonylamino)-5-(2-hydroxyethyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)NC1CC(CCO)CN(C(=O)OC)C1 |
| InChI | InChI=1S/C12H22N2O5/c1-3-19-11(16)13-10-6-9(4-5-15)7-14(8-10)12(17)18-2/h9-10,15H,3-8H2,1-2H3,(H,13,16) |
| InChIKey | GPFODVKWWNIHRV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |