C9H17NO3 — CID 102445283
[(3S,4S)-4-hydroxy-1,4-dimethylpiperidin-3-yl] acetate (PubChem CID 102445283) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is [(3S,4S)-4-hydroxy-1,4-dimethylpiperidin-3-yl] acetate.
| Compound Name | [(3S,4S)-4-hydroxy-1,4-dimethylpiperidin-3-yl] acetate |
|---|---|
| PubChem CID | 102445283 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | [(3S,4S)-4-hydroxy-1,4-dimethylpiperidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CN(C)CC[C@]1(C)O |
| InChI | InChI=1S/C9H17NO3/c1-7(11)13-8-6-10(3)5-4-9(8,2)12/h8,12H,4-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | SJKVHGKGGLYURA-IUCAKERBSA-N |
| XLogP | 0.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |