8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid

C9H15NO4 — CID 83819350

IUPAC8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid
SMILESCN1CCC2(OCCO2)C(C(=O)O)C1
InChIInChI=1S/C9H15NO4/c1-10-3-2-9(13-4-5-14-9)7(6-10)8(11)12/h7H,2-6H2,1H3,(H,11,12)
InChIKeyGTBZRTXOWOKJMR-UHFFFAOYSA-N
MW201.22 g/mol
LogP-0.23
Rot. Bonds1

About 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid

8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid (PubChem CID 83819350) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid.

Molecular Properties

Compound Name8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid
PubChem CID83819350
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid
SMILESCN1CCC2(OCCO2)C(C(=O)O)C1
InChIInChI=1S/C9H15NO4/c1-10-3-2-9(13-4-5-14-9)7(6-10)8(11)12/h7H,2-6H2,1H3,(H,11,12)
InChIKeyGTBZRTXOWOKJMR-UHFFFAOYSA-N
XLogP-0.23
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 5-0.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid?
The IUPAC name of 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid (CID 83819350) is 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid.
What is the SMILES notation for 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid?
The canonical SMILES for 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid is CN1CCC2(OCCO2)C(C(=O)O)C1.
What is the InChIKey of 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid?
The InChIKey is GTBZRTXOWOKJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-10-3-2-9(13-4-5-14-9)7(6-10)8(11)12/h7H,2-6H2,1H3,(H,11,12).
What are the key properties of 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid?
8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid has a molecular weight of 201.22 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,4-dioxa-8-azaspiro[4.5]decane-6-carboxylic acid is sourced from PubChem (CID 83819350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).