C8H17NO2 — CID 166167558
(3S,4R)-4-(hydroxymethyl)-1,4-dimethylpiperidin-3-ol (PubChem CID 166167558) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (3S,4R)-4-(hydroxymethyl)-1,4-dimethylpiperidin-3-ol.
| Compound Name | (3S,4R)-4-(hydroxymethyl)-1,4-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 166167558 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3S,4R)-4-(hydroxymethyl)-1,4-dimethylpiperidin-3-ol |
| SMILES | CN1CC[C@](C)(CO)[C@H](O)C1 |
| InChI | InChI=1S/C8H17NO2/c1-8(6-10)3-4-9(2)5-7(8)11/h7,10-11H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | GLHFZGOHWLTFQP-HTQZYQBOSA-N |
| XLogP | -0.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |