C7H16N2O — CID 14999065
1,4-dimethyl-1,4-diazepan-6-ol (PubChem CID 14999065) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is 1,4-dimethyl-1,4-diazepan-6-ol.
| Compound Name | 1,4-dimethyl-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 14999065 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1,4-dimethyl-1,4-diazepan-6-ol |
| SMILES | CN1CCN(C)CC(O)C1 |
| InChI | InChI=1S/C7H16N2O/c1-8-3-4-9(2)6-7(10)5-8/h7,10H,3-6H2,1-2H3 |
| InChIKey | SGPGVLDQKUYCPJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |