C8H17NO — CID 118230247
1,6-dimethylazepan-3-ol (PubChem CID 118230247) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 1,6-dimethylazepan-3-ol.
| Compound Name | 1,6-dimethylazepan-3-ol |
|---|---|
| PubChem CID | 118230247 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 1,6-dimethylazepan-3-ol |
| SMILES | CC1CCC(O)CN(C)C1 |
| InChI | InChI=1S/C8H17NO/c1-7-3-4-8(10)6-9(2)5-7/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | HDPUJUVFJIVFMI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |