C8H15NO — CID 147950414
(3aR,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 147950414) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3aR,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aR,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 147950414 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3aR,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | CN1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C8H15NO/c1-9-4-6-2-8(10)3-7(6)5-9/h6-8,10H,2-5H2,1H3/t6-,7+,8? |
| InChIKey | INMRQPCQBZXSTH-DHBOJHSNSA-N |
| XLogP | 0.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |