About but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen
but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen (PubChem CID 170630185) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen.
Molecular Properties
| Compound Name | but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen |
| PubChem CID | 170630185 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen |
| SMILES | CC#CC.CN1CC2CC2C1.[H][H] |
| InChI | InChI=1S/C6H11N.C4H6.H2/c1-7-3-5-2-6(5)4-7;1-3-4-2;/h5-6H,2-4H2,1H3;1-2H3;1H |
| InChIKey | BABNRMXGOAYUFZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
The IUPAC name of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen (CID 170630185) is but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen.
What is the SMILES notation for but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
The canonical SMILES for but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen is CC#CC.CN1CC2CC2C1.[H][H].
What is the InChIKey of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
The InChIKey is BABNRMXGOAYUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C4H6.H2/c1-7-3-5-2-6(5)4-7;1-3-4-2;/h5-6H,2-4H2,1H3;1-2H3;1H.
What are the key properties of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen has a molecular weight of 153.27 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen is sourced from PubChem (CID 170630185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).