but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen

C10H19N — CID 170630185

IUPACbut-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen
SMILESCC#CC.CN1CC2CC2C1.[H][H]
InChIInChI=1S/C6H11N.C4H6.H2/c1-7-3-5-2-6(5)4-7;1-3-4-2;/h5-6H,2-4H2,1H3;1-2H3;1H
InChIKeyBABNRMXGOAYUFZ-UHFFFAOYSA-N
MW153.27 g/mol
LogP1.84
Rot. Bonds

About but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen

but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen (PubChem CID 170630185) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen.

Molecular Properties

Compound Namebut-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen
PubChem CID170630185
Molecular FormulaC10H19N
Molecular Weight153.27 g/mol
Exact Mass153.15
IUPAC Namebut-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen
SMILESCC#CC.CN1CC2CC2C1.[H][H]
InChIInChI=1S/C6H11N.C4H6.H2/c1-7-3-5-2-6(5)4-7;1-3-4-2;/h5-6H,2-4H2,1H3;1-2H3;1H
InChIKeyBABNRMXGOAYUFZ-UHFFFAOYSA-N
XLogP1.84
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.27
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
The IUPAC name of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen (CID 170630185) is but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen.
What is the SMILES notation for but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
The canonical SMILES for but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen is CC#CC.CN1CC2CC2C1.[H][H].
What is the InChIKey of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
The InChIKey is BABNRMXGOAYUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C4H6.H2/c1-7-3-5-2-6(5)4-7;1-3-4-2;/h5-6H,2-4H2,1H3;1-2H3;1H.
What are the key properties of but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen?
but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen has a molecular weight of 153.27 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-yne;3-methyl-3-azabicyclo[3.1.0]hexane;molecular hydrogen is sourced from PubChem (CID 170630185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).