C12H27N3 — CID 154027656
1,3,5,7,9-pentamethyl-1,3,7-triazecane (PubChem CID 154027656) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 1,3,5,7,9-pentamethyl-1,3,7-triazecane.
| Compound Name | 1,3,5,7,9-pentamethyl-1,3,7-triazecane |
|---|---|
| PubChem CID | 154027656 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1,3,5,7,9-pentamethyl-1,3,7-triazecane |
| SMILES | CC1CN(C)CC(C)CN(C)CN(C)C1 |
| InChI | InChI=1S/C12H27N3/c1-11-6-13(3)7-12(2)9-15(5)10-14(4)8-11/h11-12H,6-10H2,1-5H3 |
| InChIKey | YVTXWJNZIRCQTK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |