C6H14N2 — CID 13109377
1,3,4-trimethylimidazolidine (PubChem CID 13109377) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 1,3,4-trimethylimidazolidine.
| Compound Name | 1,3,4-trimethylimidazolidine |
|---|---|
| PubChem CID | 13109377 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 1,3,4-trimethylimidazolidine |
| SMILES | CC1CN(C)CN1C |
| InChI | InChI=1S/C6H14N2/c1-6-4-7(2)5-8(6)3/h6H,4-5H2,1-3H3 |
| InChIKey | IBXOTQVBNFBJFM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |