C14H32N4 — CID 145359849
1,4-dimethylpiperazine;1,2,4,6-tetramethylpiperazine (PubChem CID 145359849) has the molecular formula C14H32N4 and a molecular weight of 256.44 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;1,2,4,6-tetramethylpiperazine.
| Compound Name | 1,4-dimethylpiperazine;1,2,4,6-tetramethylpiperazine |
|---|---|
| PubChem CID | 145359849 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 1,4-dimethylpiperazine;1,2,4,6-tetramethylpiperazine |
| SMILES | CC1CN(C)CC(C)N1C.CN1CCN(C)CC1 |
| InChI | InChI=1S/C8H18N2.C6H14N2/c1-7-5-9(3)6-8(2)10(7)4;1-7-3-5-8(2)6-4-7/h7-8H,5-6H2,1-4H3;3-6H2,1-2H3 |
| InChIKey | GGHNEXJRRWGIFG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |