C6H13IN2 — CID 139406604
(2S)-1-iodo-2,4-dimethylpiperazine (PubChem CID 139406604) has the molecular formula C6H13IN2 and a molecular weight of 240.09 g/mol. Its IUPAC name is (2S)-1-iodo-2,4-dimethylpiperazine.
| Compound Name | (2S)-1-iodo-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 139406604 |
| Molecular Formula | C6H13IN2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | (2S)-1-iodo-2,4-dimethylpiperazine |
| SMILES | C[C@H]1CN(C)CCN1I |
| InChI | InChI=1S/C6H13IN2/c1-6-5-8(2)3-4-9(6)7/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | VEFYDMWEPPAPKH-LURJTMIESA-N |
| XLogP | 0.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|