About (2S)-1-iodo-2,4-dimethylpiperazine
(2S)-1-iodo-2,4-dimethylpiperazine (PubChem CID 139406604) has the molecular formula C6H13IN2
and a molecular weight of 240.09 g/mol. Its IUPAC name is (2S)-1-iodo-2,4-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S)-1-iodo-2,4-dimethylpiperazine |
| PubChem CID | 139406604 |
| Molecular Formula | C6H13IN2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | (2S)-1-iodo-2,4-dimethylpiperazine |
| SMILES | C[C@H]1CN(C)CCN1I |
| InChI | InChI=1S/C6H13IN2/c1-6-5-8(2)3-4-9(6)7/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | VEFYDMWEPPAPKH-LURJTMIESA-N |
| XLogP | 0.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-iodo-2,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-iodo-2,4-dimethylpiperazine?
The IUPAC name of (2S)-1-iodo-2,4-dimethylpiperazine (CID 139406604) is (2S)-1-iodo-2,4-dimethylpiperazine.
What is the SMILES notation for (2S)-1-iodo-2,4-dimethylpiperazine?
The canonical SMILES for (2S)-1-iodo-2,4-dimethylpiperazine is C[C@H]1CN(C)CCN1I.
What is the InChIKey of (2S)-1-iodo-2,4-dimethylpiperazine?
The InChIKey is VEFYDMWEPPAPKH-LURJTMIESA-N. The full InChI is InChI=1S/C6H13IN2/c1-6-5-8(2)3-4-9(6)7/h6H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of (2S)-1-iodo-2,4-dimethylpiperazine?
(2S)-1-iodo-2,4-dimethylpiperazine has a molecular weight of 240.09 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-iodo-2,4-dimethylpiperazine is sourced from PubChem (CID 139406604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).