C9H19IN2 — CID 126995640
1-(3-iodopropyl)-2,4-dimethylpiperazine (PubChem CID 126995640) has the molecular formula C9H19IN2 and a molecular weight of 282.17 g/mol. Its IUPAC name is 1-(3-iodopropyl)-2,4-dimethylpiperazine.
| Compound Name | 1-(3-iodopropyl)-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 126995640 |
| Molecular Formula | C9H19IN2 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-(3-iodopropyl)-2,4-dimethylpiperazine |
| SMILES | CC1CN(C)CCN1CCCI |
| InChI | InChI=1S/C9H19IN2/c1-9-8-11(2)6-7-12(9)5-3-4-10/h9H,3-8H2,1-2H3 |
| InChIKey | HMXXGQGSARHLDH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|