C10H20N4 — CID 121451203
(Z)-2-[2-(2,4-dimethylpiperazin-1-yl)ethylideneamino]ethenamine (PubChem CID 121451203) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is (Z)-2-[2-(2,4-dimethylpiperazin-1-yl)ethylideneamino]ethenamine.
| Compound Name | (Z)-2-[2-(2,4-dimethylpiperazin-1-yl)ethylideneamino]ethenamine |
|---|---|
| PubChem CID | 121451203 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | (Z)-2-[2-(2,4-dimethylpiperazin-1-yl)ethylideneamino]ethenamine |
| SMILES | CC1CN(C)CCN1C/C=N/C=C\N |
| InChI | InChI=1S/C10H20N4/c1-10-9-13(2)7-8-14(10)6-5-12-4-3-11/h3-5,10H,6-9,11H2,1-2H3/b4-3-,12-5+ |
| InChIKey | AZUSJULQIBBWGD-IVNKHWRPSA-N |
| XLogP | 0.12 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|