C9H17ClN2 — CID 131236986
1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperazine (PubChem CID 131236986) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperazine.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 131236986 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperazine |
| SMILES | CC1CN(C)CCN1C/C=C/Cl |
| InChI | InChI=1S/C9H17ClN2/c1-9-8-11(2)6-7-12(9)5-3-4-10/h3-4,9H,5-8H2,1-2H3/b4-3+ |
| InChIKey | CRHNFQQAJBPFJB-ONEGZZNKSA-N |
| XLogP | 1.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |