C10H18ClN — CID 131246025
(2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine (PubChem CID 131246025) has the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. Its IUPAC name is (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine.
| Compound Name | (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine |
|---|---|
| PubChem CID | 131246025 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine |
| SMILES | C[C@H]1CCN(C/C=C/Cl)[C@@H](C)C1 |
| InChI | InChI=1S/C10H18ClN/c1-9-4-7-12(6-3-5-11)10(2)8-9/h3,5,9-10H,4,6-8H2,1-2H3/b5-3+/t9-,10-/m0/s1 |
| InChIKey | AEUWEXNNVZKMDS-GMRPRLDHSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |