About (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine
(2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine (PubChem CID 131246025) has the molecular formula C10H18ClN
and a molecular weight of 187.71 g/mol. Its IUPAC name is (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine.
Molecular Properties
| Compound Name | (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine |
| PubChem CID | 131246025 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine |
| SMILES | C[C@H]1CCN(C/C=C/Cl)[C@@H](C)C1 |
| InChI | InChI=1S/C10H18ClN/c1-9-4-7-12(6-3-5-11)10(2)8-9/h3,5,9-10H,4,6-8H2,1-2H3/b5-3+/t9-,10-/m0/s1 |
| InChIKey | AEUWEXNNVZKMDS-GMRPRLDHSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine?
The IUPAC name of (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine (CID 131246025) is (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine.
What is the SMILES notation for (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine?
The canonical SMILES for (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine is C[C@H]1CCN(C/C=C/Cl)[C@@H](C)C1.
What is the InChIKey of (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine?
The InChIKey is AEUWEXNNVZKMDS-GMRPRLDHSA-N. The full InChI is InChI=1S/C10H18ClN/c1-9-4-7-12(6-3-5-11)10(2)8-9/h3,5,9-10H,4,6-8H2,1-2H3/b5-3+/t9-,10-/m0/s1.
What are the key properties of (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine?
(2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine has a molecular weight of 187.71 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-1-[(E)-3-chloroprop-2-enyl]-2,4-dimethylpiperidine is sourced from PubChem (CID 131246025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).