C9H16ClN — CID 131241942
1-[(E)-3-chloroprop-2-enyl]-2,3-dimethylpyrrolidine (PubChem CID 131241942) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-2,3-dimethylpyrrolidine.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-2,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 131241942 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-2,3-dimethylpyrrolidine |
| SMILES | CC1CCN(C/C=C/Cl)C1C |
| InChI | InChI=1S/C9H16ClN/c1-8-4-7-11(9(8)2)6-3-5-10/h3,5,8-9H,4,6-7H2,1-2H3/b5-3+ |
| InChIKey | UGULHFAYEOCRHC-HWKANZROSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |